C26H23ClN2O3 — CID 10343558
2-(3-chlorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoic acid (PubChem CID 10343558) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoic acid.
| Compound Name | 2-(3-chlorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 10343558 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-(3-chlorophenyl)-3-[1-(4-methoxyphenyl)-5-(4-methylphenyl)pyrazol-3-yl]propanoic acid |
| SMILES | COc1ccc(-n2nc(CC(C(=O)O)c3cccc(Cl)c3)cc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN2O3/c1-17-6-8-18(9-7-17)25-16-21(28-29(25)22-10-12-23(32-2)13-11-22)15-24(26(30)31)19-4-3-5-20(27)14-19/h3-14,16,24H,15H2,1-2H3,(H,30,31) |
| InChIKey | JIQFZEYWMAMZLY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |