C6H10N4O3S — CID 103436500
2-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103436500) has the molecular formula C6H10N4O3S and a molecular weight of 218.24 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103436500 |
| Molecular Formula | C6H10N4O3S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | Nc1nnc(NC2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C6H10N4O3S/c7-5-9-10-6(13-5)8-4-1-2-14(11,12)3-4/h4H,1-3H2,(H2,7,9)(H,8,10) |
| InChIKey | IYSHBPQYQAMXTC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |