C7H12N4O3S — CID 103436684
2-N-(1,1-dioxothian-4-yl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103436684) has the molecular formula C7H12N4O3S and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-N-(1,1-dioxothian-4-yl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(1,1-dioxothian-4-yl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103436684 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-N-(1,1-dioxothian-4-yl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | Nc1nnc(NC2CCS(=O)(=O)CC2)o1 |
| InChI | InChI=1S/C7H12N4O3S/c8-6-10-11-7(14-6)9-5-1-3-15(12,13)4-2-5/h5H,1-4H2,(H2,8,10)(H,9,11) |
| InChIKey | KBCJCXVNZVVWBV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |