C10H8N4OS — CID 103437072
2-N-(1-benzothiophen-5-yl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437072) has the molecular formula C10H8N4OS and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-N-(1-benzothiophen-5-yl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(1-benzothiophen-5-yl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437072 |
| Molecular Formula | C10H8N4OS |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-N-(1-benzothiophen-5-yl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | Nc1nnc(Nc2ccc3sccc3c2)o1 |
| InChI | InChI=1S/C10H8N4OS/c11-9-13-14-10(15-9)12-7-1-2-8-6(5-7)3-4-16-8/h1-5H,(H2,11,13)(H,12,14) |
| InChIKey | SOFXDPJILBFYAX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |