C7H14N4O2S — CID 103437297
2-N-(3-methylsulfinylbutyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437297) has the molecular formula C7H14N4O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-N-(3-methylsulfinylbutyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(3-methylsulfinylbutyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437297 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-N-(3-methylsulfinylbutyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | CC(CCNc1nnc(N)o1)S(C)=O |
| InChI | InChI=1S/C7H14N4O2S/c1-5(14(2)12)3-4-9-7-11-10-6(8)13-7/h5H,3-4H2,1-2H3,(H2,8,10)(H,9,11) |
| InChIKey | GRTQULCKMONLMZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |