C7H14N4OS — CID 103437299
2-N-(4-methylsulfanylbutyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437299) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-N-(4-methylsulfanylbutyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(4-methylsulfanylbutyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437299 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-N-(4-methylsulfanylbutyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | CSCCCCNc1nnc(N)o1 |
| InChI | InChI=1S/C7H14N4OS/c1-13-5-3-2-4-9-7-11-10-6(8)12-7/h2-5H2,1H3,(H2,8,10)(H,9,11) |
| InChIKey | SBXWCZBZECASAI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|