C8H14N4O — CID 103437308
2-N-(1-ethylcyclobutyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437308) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-N-(1-ethylcyclobutyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(1-ethylcyclobutyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437308 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-N-(1-ethylcyclobutyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | CCC1(Nc2nnc(N)o2)CCC1 |
| InChI | InChI=1S/C8H14N4O/c1-2-8(4-3-5-8)10-7-12-11-6(9)13-7/h2-5H2,1H3,(H2,9,11)(H,10,12) |
| InChIKey | JWHVKKHVEBXHKV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |