C8H14N4OS — CID 103437312
2-N-(thian-4-ylmethyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437312) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-N-(thian-4-ylmethyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(thian-4-ylmethyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437312 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-N-(thian-4-ylmethyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | Nc1nnc(NCC2CCSCC2)o1 |
| InChI | InChI=1S/C8H14N4OS/c9-7-11-12-8(13-7)10-5-6-1-3-14-4-2-6/h6H,1-5H2,(H2,9,11)(H,10,12) |
| InChIKey | ZHXLYWJEJDYPLT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |