C7H12N4OS — CID 103437375
2-N-(thian-3-yl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437375) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-N-(thian-3-yl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(thian-3-yl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437375 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-N-(thian-3-yl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | Nc1nnc(NC2CCCSC2)o1 |
| InChI | InChI=1S/C7H12N4OS/c8-6-10-11-7(12-6)9-5-2-1-3-13-4-5/h5H,1-4H2,(H2,8,10)(H,9,11) |
| InChIKey | AWXMVEFSEQHLCL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |