C16H24N2OSi — CID 103437907
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine (PubChem CID 103437907) has the molecular formula C16H24N2OSi and a molecular weight of 288.47 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
|---|---|
| PubChem CID | 103437907 |
| Molecular Formula | C16H24N2OSi |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
| SMILES | Cc1noc(C)c1CNCc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2OSi/c1-12-16(13(2)19-18-12)11-17-10-14-6-8-15(9-7-14)20(3,4)5/h6-9,17H,10-11H2,1-5H3 |
| InChIKey | KXZIRDYNDDNLLZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|