C17H29NSi — CID 103437910
2,2,3,3-tetramethyl-N-[(4-trimethylsilylphenyl)methyl]cyclopropan-1-amine (PubChem CID 103437910) has the molecular formula C17H29NSi and a molecular weight of 275.51 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-[(4-trimethylsilylphenyl)methyl]cyclopropan-1-amine.
| Compound Name | 2,2,3,3-tetramethyl-N-[(4-trimethylsilylphenyl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 103437910 |
| Molecular Formula | C17H29NSi |
| Molecular Weight | 275.51 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[(4-trimethylsilylphenyl)methyl]cyclopropan-1-amine |
| SMILES | CC1(C)C(NCc2ccc([Si](C)(C)C)cc2)C1(C)C |
| InChI | InChI=1S/C17H29NSi/c1-16(2)15(17(16,3)4)18-12-13-8-10-14(11-9-13)19(5,6)7/h8-11,15,18H,12H2,1-7H3 |
| InChIKey | VZPOKGWGQJJSJY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|