C17H26N2SSi — CID 103438032
1-(5-ethyl-1,3-thiazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine (PubChem CID 103438032) has the molecular formula C17H26N2SSi and a molecular weight of 318.56 g/mol. Its IUPAC name is 1-(5-ethyl-1,3-thiazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine.
| Compound Name | 1-(5-ethyl-1,3-thiazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103438032 |
| Molecular Formula | C17H26N2SSi |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(5-ethyl-1,3-thiazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
| SMILES | CCc1cnc(C(C)NCc2ccc([Si](C)(C)C)cc2)s1 |
| InChI | InChI=1S/C17H26N2SSi/c1-6-15-12-19-17(20-15)13(2)18-11-14-7-9-16(10-8-14)21(3,4)5/h7-10,12-13,18H,6,11H2,1-5H3 |
| InChIKey | HEIYFEIONNHBJV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|