C16H28N2OSi — CID 103438048
N-propan-2-yl-3-[(4-trimethylsilylphenyl)methylamino]propanamide (PubChem CID 103438048) has the molecular formula C16H28N2OSi and a molecular weight of 292.50 g/mol. Its IUPAC name is N-propan-2-yl-3-[(4-trimethylsilylphenyl)methylamino]propanamide.
| Compound Name | N-propan-2-yl-3-[(4-trimethylsilylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 103438048 |
| Molecular Formula | C16H28N2OSi |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-propan-2-yl-3-[(4-trimethylsilylphenyl)methylamino]propanamide |
| SMILES | CC(C)NC(=O)CCNCc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H28N2OSi/c1-13(2)18-16(19)10-11-17-12-14-6-8-15(9-7-14)20(3,4)5/h6-9,13,17H,10-12H2,1-5H3,(H,18,19) |
| InChIKey | NUDPVXSUEWYGNR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|