C16H27NO2Si — CID 103438062
N-[(3-methoxyoxolan-3-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine (PubChem CID 103438062) has the molecular formula C16H27NO2Si and a molecular weight of 293.48 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
|---|---|
| PubChem CID | 103438062 |
| Molecular Formula | C16H27NO2Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-1-(4-trimethylsilylphenyl)methanamine |
| SMILES | COC1(CNCc2ccc([Si](C)(C)C)cc2)CCOC1 |
| InChI | InChI=1S/C16H27NO2Si/c1-18-16(9-10-19-13-16)12-17-11-14-5-7-15(8-6-14)20(2,3)4/h5-8,17H,9-13H2,1-4H3 |
| InChIKey | OWCXTXBAAVLVNI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|