C17H28N2Si — CID 103438232
[4-[[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]methyl]phenyl]-trimethylsilane (PubChem CID 103438232) has the molecular formula C17H28N2Si and a molecular weight of 288.51 g/mol. Its IUPAC name is [4-[[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]methyl]phenyl]-trimethylsilane.
| Compound Name | [4-[[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]methyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 103438232 |
| Molecular Formula | C17H28N2Si |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [4-[[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]methyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(CN2C[C@@H]3CCCN[C@@H]3C2)cc1 |
| InChI | InChI=1S/C17H28N2Si/c1-20(2,3)16-8-6-14(7-9-16)11-19-12-15-5-4-10-18-17(15)13-19/h6-9,15,17-18H,4-5,10-13H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | PZFYVTJWBUTPCM-DOTOQJQBSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|