C17H29NSi — CID 103438328
N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]propan-1-amine (PubChem CID 103438328) has the molecular formula C17H29NSi and a molecular weight of 275.51 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]propan-1-amine.
| Compound Name | N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103438328 |
| Molecular Formula | C17H29NSi |
| Molecular Weight | 275.51 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[(4-trimethylsilylphenyl)methyl]propan-1-amine |
| SMILES | CCCN(Cc1ccc([Si](C)(C)C)cc1)CC1CC1 |
| InChI | InChI=1S/C17H29NSi/c1-5-12-18(13-15-6-7-15)14-16-8-10-17(11-9-16)19(2,3)4/h8-11,15H,5-7,12-14H2,1-4H3 |
| InChIKey | YYFTYNFJIWKZIR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|