C18H30N2Si — CID 103438477
trimethyl-[4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]phenyl]silane (PubChem CID 103438477) has the molecular formula C18H30N2Si and a molecular weight of 302.54 g/mol. Its IUPAC name is trimethyl-[4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]phenyl]silane.
| Compound Name | trimethyl-[4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]phenyl]silane |
|---|---|
| PubChem CID | 103438477 |
| Molecular Formula | C18H30N2Si |
| Molecular Weight | 302.54 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | trimethyl-[4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]phenyl]silane |
| SMILES | CC1CN2CCCC2CN1Cc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2Si/c1-15-12-19-11-5-6-17(19)14-20(15)13-16-7-9-18(10-8-16)21(2,3)4/h7-10,15,17H,5-6,11-14H2,1-4H3 |
| InChIKey | DCIQSYVNYPFDFG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|