C16H22N2SSi — CID 103438769
[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane (PubChem CID 103438769) has the molecular formula C16H22N2SSi and a molecular weight of 302.52 g/mol. Its IUPAC name is [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane.
| Compound Name | [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 103438769 |
| Molecular Formula | C16H22N2SSi |
| Molecular Weight | 302.52 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane |
| SMILES | Cc1cc(C)nc(SCc2ccc([Si](C)(C)C)cc2)n1 |
| InChI | InChI=1S/C16H22N2SSi/c1-12-10-13(2)18-16(17-12)19-11-14-6-8-15(9-7-14)20(3,4)5/h6-10H,11H2,1-5H3 |
| InChIKey | BDGYFMFRBUGFPL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|