About [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane
[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane (PubChem CID 103438769) has the molecular formula C16H22N2SSi
and a molecular weight of 302.52 g/mol. Its IUPAC name is [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane |
| PubChem CID | 103438769 |
| Molecular Formula | C16H22N2SSi |
| Molecular Weight | 302.52 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane |
| SMILES | Cc1cc(C)nc(SCc2ccc([Si](C)(C)C)cc2)n1 |
| InChI | InChI=1S/C16H22N2SSi/c1-12-10-13(2)18-16(17-12)19-11-14-6-8-15(9-7-14)20(3,4)5/h6-10H,11H2,1-5H3 |
| InChIKey | BDGYFMFRBUGFPL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane?
The IUPAC name of [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane (CID 103438769) is [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane.
What is the SMILES notation for [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane?
The canonical SMILES for [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane is Cc1cc(C)nc(SCc2ccc([Si](C)(C)C)cc2)n1.
What is the InChIKey of [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane?
The InChIKey is BDGYFMFRBUGFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2SSi/c1-12-10-13(2)18-16(17-12)19-11-14-6-8-15(9-7-14)20(3,4)5/h6-10H,11H2,1-5H3.
What are the key properties of [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane?
[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane has a molecular weight of 302.52 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]phenyl]-trimethylsilane is sourced from PubChem (CID 103438769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).