About 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid
6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid (PubChem CID 10343923) has the molecular formula C25H24ClNO5
and a molecular weight of 453.92 g/mol. Its IUPAC name is 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid.
Molecular Properties
| Compound Name | 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid |
| PubChem CID | 10343923 |
| Molecular Formula | C25H24ClNO5 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid |
| SMILES | CC(CCCCOc1cc(-c2ccc3c(c2)OCO3)cc(-c2ccccc2Cl)n1)C(=O)O |
| InChI | InChI=1S/C25H24ClNO5/c1-16(25(28)29)6-4-5-11-30-24-14-18(17-9-10-22-23(13-17)32-15-31-22)12-21(27-24)19-7-2-3-8-20(19)26/h2-3,7-10,12-14,16H,4-6,11,15H2,1H3,(H,28,29) |
| InChIKey | LKWMUZSBLQRLJV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid?
The IUPAC name of 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid (CID 10343923) is 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid.
What is the SMILES notation for 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid?
The canonical SMILES for 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid is CC(CCCCOc1cc(-c2ccc3c(c2)OCO3)cc(-c2ccccc2Cl)n1)C(=O)O.
What is the InChIKey of 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid?
The InChIKey is LKWMUZSBLQRLJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClNO5/c1-16(25(28)29)6-4-5-11-30-24-14-18(17-9-10-22-23(13-17)32-15-31-22)12-21(27-24)19-7-2-3-8-20(19)26/h2-3,7-10,12-14,16H,4-6,11,15H2,1H3,(H,28,29).
What are the key properties of 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid?
6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid has a molecular weight of 453.92 g/mol, XLogP of 6.07, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(1,3-benzodioxol-5-yl)-6-(2-chlorophenyl)-2-pyridinyl]oxy]-2-methylhexanoic acid is sourced from PubChem (CID 10343923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).