C28H32N4O2 — CID 10344052
2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetic acid (PubChem CID 10344052) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetic acid.
| Compound Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 10344052 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetic acid |
| SMILES | CCCN(c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O2/c1-5-16-31(26(28(33)34)22-10-8-7-9-11-22)23-14-12-21(13-15-23)18-32-24(6-2)30-25-19(3)17-20(4)29-27(25)32/h7-15,17,26H,5-6,16,18H2,1-4H3,(H,33,34) |
| InChIKey | IBOMUNBFESSIAD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|