C25H44O7 — CID 10344054
(1S,2R,3E,7S,18R)-2-(2-methoxyethoxymethoxy)-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one (PubChem CID 10344054) has the molecular formula C25H44O7 and a molecular weight of 456.62 g/mol. Its IUPAC name is (1S,2R,3E,7S,18R)-2-(2-methoxyethoxymethoxy)-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one.
| Compound Name | (1S,2R,3E,7S,18R)-2-(2-methoxyethoxymethoxy)-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one |
|---|---|
| PubChem CID | 10344054 |
| Molecular Formula | C25H44O7 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | (1S,2R,3E,7S,18R)-2-(2-methoxyethoxymethoxy)-7,20,20-trimethyl-6,19,21-trioxabicyclo[16.3.0]henicos-3-en-5-one |
| SMILES | COCCOCO[C@@H]1/C=C/C(=O)O[C@@H](C)CCCCCCCCCC[C@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C25H44O7/c1-20-13-11-9-7-5-6-8-10-12-14-22-24(32-25(2,3)31-22)21(15-16-23(26)30-20)29-19-28-18-17-27-4/h15-16,20-22,24H,5-14,17-19H2,1-4H3/b16-15+/t20-,21+,22+,24+/m0/s1 |
| InChIKey | ZARDBUTXDHKGEO-IJPFKPQJSA-N |
| XLogP | 4.91 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|