C13H19N3O3 — CID 103440801
4-[2-(aminomethyl)-4-methylpiperidine-1-carbonyl]-6-hydroxy-1H-pyridin-2-one (PubChem CID 103440801) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-4-methylpiperidine-1-carbonyl]-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 4-[2-(aminomethyl)-4-methylpiperidine-1-carbonyl]-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 103440801 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-[2-(aminomethyl)-4-methylpiperidine-1-carbonyl]-6-hydroxy-1H-pyridin-2-one |
| SMILES | CC1CCN(C(=O)c2cc(O)[nH]c(=O)c2)C(CN)C1 |
| InChI | InChI=1S/C13H19N3O3/c1-8-2-3-16(10(4-8)7-14)13(19)9-5-11(17)15-12(18)6-9/h5-6,8,10H,2-4,7,14H2,1H3,(H2,15,17,18) |
| InChIKey | MFOMRVMOISGMNF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |