About [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone
[2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone (PubChem CID 103441091) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone |
| PubChem CID | 103441091 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CCC(C)CC2CN)o1 |
| InChI | InChI=1S/C13H21N3O2/c1-8-4-5-16(11(6-8)7-14)13(17)12-9(2)15-10(3)18-12/h8,11H,4-7,14H2,1-3H3 |
| InChIKey | WYEJPXFKIDPGGZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone?
The IUPAC name of [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone (CID 103441091) is [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone.
What is the SMILES notation for [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone?
The canonical SMILES for [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone is Cc1nc(C)c(C(=O)N2CCC(C)CC2CN)o1.
What is the InChIKey of [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone?
The InChIKey is WYEJPXFKIDPGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-8-4-5-16(11(6-8)7-14)13(17)12-9(2)15-10(3)18-12/h8,11H,4-7,14H2,1-3H3.
What are the key properties of [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone?
[2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone has a molecular weight of 251.33 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)-4-methylpiperidin-1-yl]-(2,4-dimethyl-1,3-oxazol-5-yl)methanone is sourced from PubChem (CID 103441091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).