C13H20N4O3 — CID 103441279
[2-(aminomethyl)-4-methylpiperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone (PubChem CID 103441279) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methylpiperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone.
| Compound Name | [2-(aminomethyl)-4-methylpiperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 103441279 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [2-(aminomethyl)-4-methylpiperidin-1-yl]-(1-methyl-5-nitropyrrol-2-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc([N+](=O)[O-])n2C)C(CN)C1 |
| InChI | InChI=1S/C13H20N4O3/c1-9-5-6-16(10(7-9)8-14)13(18)11-3-4-12(15(11)2)17(19)20/h3-4,9-10H,5-8,14H2,1-2H3 |
| InChIKey | RKXRHPMYRDKVIE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|