C28H32N2O4 — CID 10344238
methyl (2Z)-2-[1'-benzyl-2'-[(E)-3-(2-methyl-1,3-dioxolan-2-yl)prop-1-enyl]spiro[1H-indole-3,3'-pyrrolidine]-2-ylidene]acetate (PubChem CID 10344238) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is methyl (2Z)-2-[1'-benzyl-2'-[(E)-3-(2-methyl-1,3-dioxolan-2-yl)prop-1-enyl]spiro[1H-indole-3,3'-pyrrolidine]-2-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[1'-benzyl-2'-[(E)-3-(2-methyl-1,3-dioxolan-2-yl)prop-1-enyl]spiro[1H-indole-3,3'-pyrrolidine]-2-ylidene]acetate |
|---|---|
| PubChem CID | 10344238 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | methyl (2Z)-2-[1'-benzyl-2'-[(E)-3-(2-methyl-1,3-dioxolan-2-yl)prop-1-enyl]spiro[1H-indole-3,3'-pyrrolidine]-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1\Nc2ccccc2C12CCN(Cc1ccccc1)C2/C=C/CC1(C)OCCO1 |
| InChI | InChI=1S/C28H32N2O4/c1-27(33-17-18-34-27)14-8-13-25-28(15-16-30(25)20-21-9-4-3-5-10-21)22-11-6-7-12-23(22)29-24(28)19-26(31)32-2/h3-13,19,25,29H,14-18,20H2,1-2H3/b13-8+,24-19- |
| InChIKey | FIQMFELNYNSMEL-PYBKPPLCSA-N |
| XLogP | 4.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|