C14H12ClNO — CID 103443191
(3-chloro-2-pyridinyl)-(3,5-dimethylphenyl)methanone (PubChem CID 103443191) has the molecular formula C14H12ClNO and a molecular weight of 245.71 g/mol. Its IUPAC name is (3-chloro-2-pyridinyl)-(3,5-dimethylphenyl)methanone.
| Compound Name | (3-chloro-2-pyridinyl)-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 103443191 |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (3-chloro-2-pyridinyl)-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)c2ncccc2Cl)c1 |
| InChI | InChI=1S/C14H12ClNO/c1-9-6-10(2)8-11(7-9)14(17)13-12(15)4-3-5-16-13/h3-8H,1-2H3 |
| InChIKey | XKAZQIVKSGQKLX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |