C24H36O7Si — CID 10344396
(1S,2S)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-diol (PubChem CID 10344396) has the molecular formula C24H36O7Si and a molecular weight of 464.63 g/mol. Its IUPAC name is (1S,2S)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-diol.
| Compound Name | (1S,2S)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 10344396 |
| Molecular Formula | C24H36O7Si |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (1S,2S)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-2-(3,4,5-trimethoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc([C@H](O)[C@@H](O)c2cc(OC)c(OC)c(OC)c2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36O7Si/c1-24(2,3)32(8,9)31-18-12-15(10-11-17(18)27-4)21(25)22(26)16-13-19(28-5)23(30-7)20(14-16)29-6/h10-14,21-22,25-26H,1-9H3/t21-,22-/m0/s1 |
| InChIKey | LWMRWPBWSYSVCW-VXKWHMMOSA-N |
| XLogP | 4.87 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|