About [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate
[1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate (PubChem CID 10344454) has the molecular formula C24H18O10
and a molecular weight of 466.40 g/mol. Its IUPAC name is [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate.
Molecular Properties
| Compound Name | [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate |
| PubChem CID | 10344454 |
| Molecular Formula | C24H18O10 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate |
| SMILES | CC(=O)Oc1c(-c2ccc(O)cc2)c(OC(C)=O)c2oc3cc(O)c(O)cc3c2c1OC(C)=O |
| InChI | InChI=1S/C24H18O10/c1-10(25)31-21-19(13-4-6-14(28)7-5-13)22(32-11(2)26)24-20(23(21)33-12(3)27)15-8-16(29)17(30)9-18(15)34-24/h4-9,28-30H,1-3H3 |
| InChIKey | DTOIFOOSMQSUBD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate?
The IUPAC name of [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate (CID 10344454) is [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate.
What is the SMILES notation for [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate?
The canonical SMILES for [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate is CC(=O)Oc1c(-c2ccc(O)cc2)c(OC(C)=O)c2oc3cc(O)c(O)cc3c2c1OC(C)=O.
What is the InChIKey of [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate?
The InChIKey is DTOIFOOSMQSUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O10/c1-10(25)31-21-19(13-4-6-14(28)7-5-13)22(32-11(2)26)24-20(23(21)33-12(3)27)15-8-16(29)17(30)9-18(15)34-24/h4-9,28-30H,1-3H3.
What are the key properties of [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate?
[1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate has a molecular weight of 466.40 g/mol, XLogP of 4.15, 4 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-diacetyloxy-7,8-dihydroxy-3-(4-hydroxyphenyl)dibenzofuran-4-yl] acetate is sourced from PubChem (CID 10344454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).