About 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one
2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one (PubChem CID 103446026) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one.
Molecular Properties
| Compound Name | 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one |
| PubChem CID | 103446026 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one |
| SMILES | COC(C)(C)CCC(=O)C(C)(C)O |
| InChI | InChI=1S/C10H20O3/c1-9(2,13-5)7-6-8(11)10(3,4)12/h12H,6-7H2,1-5H3 |
| InChIKey | CVPWIVRPSPPVEU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one?
The IUPAC name of 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one (CID 103446026) is 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one.
What is the SMILES notation for 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one?
The canonical SMILES for 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one is COC(C)(C)CCC(=O)C(C)(C)O.
What is the InChIKey of 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one?
The InChIKey is CVPWIVRPSPPVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-9(2,13-5)7-6-8(11)10(3,4)12/h12H,6-7H2,1-5H3.
What are the key properties of 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one?
2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one has a molecular weight of 188.27 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-6-methoxy-2,6-dimethylheptan-3-one is sourced from PubChem (CID 103446026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).