About tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate
tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate (PubChem CID 10344659) has the molecular formula C28H30N4O3
and a molecular weight of 470.57 g/mol. Its IUPAC name is tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate |
| PubChem CID | 10344659 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate |
| SMILES | Cc1[nH]c(C(=O)OC(C)(C)C)c(C)c1-c1ccnc(Nc2cccc(OCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C28H30N4O3/c1-18-24(19(2)30-25(18)26(33)35-28(3,4)5)23-14-15-29-27(32-23)31-21-12-9-13-22(16-21)34-17-20-10-7-6-8-11-20/h6-16,30H,17H2,1-5H3,(H,29,31,32) |
| InChIKey | BBDZWGXSHVEUTF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate?
The IUPAC name of tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate (CID 10344659) is tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate?
The canonical SMILES for tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate is Cc1[nH]c(C(=O)OC(C)(C)C)c(C)c1-c1ccnc(Nc2cccc(OCc3ccccc3)c2)n1.
What is the InChIKey of tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate?
The InChIKey is BBDZWGXSHVEUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N4O3/c1-18-24(19(2)30-25(18)26(33)35-28(3,4)5)23-14-15-29-27(32-23)31-21-12-9-13-22(16-21)34-17-20-10-7-6-8-11-20/h6-16,30H,17H2,1-5H3,(H,29,31,32).
What are the key properties of tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate?
tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate has a molecular weight of 470.57 g/mol, XLogP of 6.37, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,5-dimethyl-4-[2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 10344659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).