C19H10Cl4N2O2S — CID 10344727
5,6-bis(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione (PubChem CID 10344727) has the molecular formula C19H10Cl4N2O2S and a molecular weight of 472.18 g/mol. Its IUPAC name is 5,6-bis(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5,6-bis(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 10344727 |
| Molecular Formula | C19H10Cl4N2O2S |
| Molecular Weight | 472.18 g/mol |
| Exact Mass | 469.92 |
| IUPAC Name | 5,6-bis(2,3-dichlorophenoxy)-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2cc(Oc3cccc(Cl)c3Cl)c(Oc3cccc(Cl)c3Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H10Cl4N2O2S/c20-9-3-1-5-13(17(9)22)26-15-7-11-12(25-19(28)24-11)8-16(15)27-14-6-2-4-10(21)18(14)23/h1-8H,(H2,24,25,28) |
| InChIKey | AYAVMEWEYPDNDO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.18 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|