C14H21BrN2O — CID 103447397
1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-ethylpent-3-en-2-one (PubChem CID 103447397) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-ethylpent-3-en-2-one.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-ethylpent-3-en-2-one |
|---|---|
| PubChem CID | 103447397 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-ethylpent-3-en-2-one |
| SMILES | CC=C(CC)C(=O)Cc1c(Br)c(CC)nn1CC |
| InChI | InChI=1S/C14H21BrN2O/c1-5-10(6-2)13(18)9-12-14(15)11(7-3)16-17(12)8-4/h5H,6-9H2,1-4H3 |
| InChIKey | YVYSWLZOIRHVSG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|