C27H32N6S — CID 10344755
4,5-dimethyl-2-[4-[4-(2-phenylethyl)piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole (PubChem CID 10344755) has the molecular formula C27H32N6S and a molecular weight of 472.66 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-[4-(2-phenylethyl)piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-[4-[4-(2-phenylethyl)piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 10344755 |
| Molecular Formula | C27H32N6S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 4,5-dimethyl-2-[4-[4-(2-phenylethyl)piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole |
| SMILES | Cc1nc(-c2c3n(c4c(N5CCN(CCc6ccccc6)CC5)ncnc24)CCCC3)sc1C |
| InChI | InChI=1S/C27H32N6S/c1-19-20(2)34-27(30-19)23-22-10-6-7-12-33(22)25-24(23)28-18-29-26(25)32-16-14-31(15-17-32)13-11-21-8-4-3-5-9-21/h3-5,8-9,18H,6-7,10-17H2,1-2H3 |
| InChIKey | QRCGJSMPOQYGMN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |