C12H16N2O — CID 103448076
cyclopenten-1-yl-(1-propylimidazol-2-yl)methanone (PubChem CID 103448076) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is cyclopenten-1-yl-(1-propylimidazol-2-yl)methanone.
| Compound Name | cyclopenten-1-yl-(1-propylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 103448076 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | cyclopenten-1-yl-(1-propylimidazol-2-yl)methanone |
| SMILES | CCCn1ccnc1C(=O)C1=CCCC1 |
| InChI | InChI=1S/C12H16N2O/c1-2-8-14-9-7-13-12(14)11(15)10-5-3-4-6-10/h5,7,9H,2-4,6,8H2,1H3 |
| InChIKey | AZVQZNKKLKVANC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |