C27H42O3SSi — CID 10344850
(6R)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-8-methylsulfanyloctane-3,4-diol (PubChem CID 10344850) has the molecular formula C27H42O3SSi and a molecular weight of 474.78 g/mol. Its IUPAC name is (6R)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-8-methylsulfanyloctane-3,4-diol.
| Compound Name | (6R)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-8-methylsulfanyloctane-3,4-diol |
|---|---|
| PubChem CID | 10344850 |
| Molecular Formula | C27H42O3SSi |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (6R)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-8-methylsulfanyloctane-3,4-diol |
| SMILES | CSCC[C@@H](CC(O)C(O)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H42O3SSi/c1-26(2,3)25(29)24(28)20-21(18-19-31-7)30-32(27(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24-25,28-29H,18-20H2,1-7H3/t21-,24?,25?/m0/s1 |
| InChIKey | HCPDCLWRFDUUKT-ANYOXOOPSA-N |
| XLogP | 4.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|