C27H30FN5O2 — CID 10344873
(3Z)-3-[(3-fluorophenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one (PubChem CID 10344873) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is (3Z)-3-[(3-fluorophenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3-fluorophenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one |
|---|---|
| PubChem CID | 10344873 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (3Z)-3-[(3-fluorophenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one |
| SMILES | COCCN1CCC(Nc2ccc3c(c2)/C(=C(\c2cccc(F)c2)c2ncc(C)[nH]2)C(=O)N3)CC1 |
| InChI | InChI=1S/C27H30FN5O2/c1-17-16-29-26(30-17)24(18-4-3-5-19(28)14-18)25-22-15-21(6-7-23(22)32-27(25)34)31-20-8-10-33(11-9-20)12-13-35-2/h3-7,14-16,20,31H,8-13H2,1-2H3,(H,29,30)(H,32,34)/b25-24- |
| InChIKey | JPRYHYAQGHPIBL-IZHYLOQSSA-N |
| XLogP | 4.29 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|