C31H28FN3O — CID 10344971
2-[(11aS)-8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-oxazole (PubChem CID 10344971) has the molecular formula C31H28FN3O and a molecular weight of 477.58 g/mol. Its IUPAC name is 2-[(11aS)-8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[(11aS)-8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 10344971 |
| Molecular Formula | C31H28FN3O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2-[(11aS)-8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-oxazole |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2=CCCC1c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C31H28FN3O/c1-31-17-21-18-34-35(24-13-11-23(32)12-14-24)28(21)16-22(31)10-15-25-26(8-5-9-27(25)31)30-33-19-29(36-30)20-6-3-2-4-7-20/h2-4,6-7,9,11-14,16,18-19,25-26H,5,8,10,15,17H2,1H3/t25?,26?,31-/m0/s1 |
| InChIKey | IRLRHTIGGGTJQN-TVTFQUIASA-N |
| XLogP | 7.53 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|