About (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone
(2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone (PubChem CID 10345044) has the molecular formula C33H21NO3
and a molecular weight of 479.54 g/mol. Its IUPAC name is (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone |
| PubChem CID | 10345044 |
| Molecular Formula | C33H21NO3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(C(=O)c2ccccc2)c2c3ccccc3ccn2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H21NO3/c35-31(23-13-4-1-5-14-23)27-28(32(36)24-15-6-2-7-16-24)30(33(37)25-17-8-3-9-18-25)34-21-20-22-12-10-11-19-26(22)29(27)34/h1-21H |
| InChIKey | CCLPZSLHSWWHLL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone?
The IUPAC name of (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone (CID 10345044) is (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone.
What is the SMILES notation for (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone?
The canonical SMILES for (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone is O=C(c1ccccc1)c1c(C(=O)c2ccccc2)c2c3ccccc3ccn2c1C(=O)c1ccccc1.
What is the InChIKey of (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone?
The InChIKey is CCLPZSLHSWWHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H21NO3/c35-31(23-13-4-1-5-14-23)27-28(32(36)24-15-6-2-7-16-24)30(33(37)25-17-8-3-9-18-25)34-21-20-22-12-10-11-19-26(22)29(27)34/h1-21H.
What are the key properties of (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone?
(2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone has a molecular weight of 479.54 g/mol, XLogP of 6.79, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dibenzoylpyrrolo[2,1-a]isoquinolin-1-yl)-phenylmethanone is sourced from PubChem (CID 10345044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).