About cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone
cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone (PubChem CID 103450456) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone.
Molecular Properties
| Compound Name | cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone |
| PubChem CID | 103450456 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone |
| SMILES | O=C(C1=CCCCCC1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C17H26O3/c18-16(14-5-3-1-2-4-6-14)15-7-10-20-17(13-15)8-11-19-12-9-17/h5,15H,1-4,6-13H2 |
| InChIKey | BMNSDDBHZJOVJL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone?
The IUPAC name of cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone (CID 103450456) is cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone.
What is the SMILES notation for cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone?
The canonical SMILES for cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone is O=C(C1=CCCCCC1)C1CCOC2(CCOCC2)C1.
What is the InChIKey of cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone?
The InChIKey is BMNSDDBHZJOVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c18-16(14-5-3-1-2-4-6-14)15-7-10-20-17(13-15)8-11-19-12-9-17/h5,15H,1-4,6-13H2.
What are the key properties of cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone?
cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone has a molecular weight of 278.39 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepten-1-yl(1,9-dioxaspiro[5.5]undecan-4-yl)methanone is sourced from PubChem (CID 103450456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).