C32H33NO3 — CID 10345059
4-[1-(furan-2-ylmethyl)-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid (PubChem CID 10345059) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is 4-[1-(furan-2-ylmethyl)-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid.
| Compound Name | 4-[1-(furan-2-ylmethyl)-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 10345059 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 4-[1-(furan-2-ylmethyl)-7,7,10,10-tetramethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)cn(Cc2ccco2)c1-3 |
| InChI | InChI=1S/C32H33NO3/c1-31(2)13-14-32(3,4)28-17-25-22(16-27(28)31)11-12-24-26(20-7-9-21(10-8-20)30(34)35)19-33(29(24)25)18-23-6-5-15-36-23/h5-10,15-17,19H,11-14,18H2,1-4H3,(H,34,35) |
| InChIKey | GQMFRJDIGQYFCC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |