C15H17IO — CID 103451249
2-(4-iodophenyl)-1-(4-methylcyclohexen-1-yl)ethanone (PubChem CID 103451249) has the molecular formula C15H17IO and a molecular weight of 340.20 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1-(4-methylcyclohexen-1-yl)ethanone.
| Compound Name | 2-(4-iodophenyl)-1-(4-methylcyclohexen-1-yl)ethanone |
|---|---|
| PubChem CID | 103451249 |
| Molecular Formula | C15H17IO |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-(4-iodophenyl)-1-(4-methylcyclohexen-1-yl)ethanone |
| SMILES | CC1CC=C(C(=O)Cc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C15H17IO/c1-11-2-6-13(7-3-11)15(17)10-12-4-8-14(16)9-5-12/h4-6,8-9,11H,2-3,7,10H2,1H3 |
| InChIKey | CSDYKWKEHRUNNF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|