C20H11Cl2F6NO2 — CID 10345145
3,5-dichloro-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]benzamide (PubChem CID 10345145) has the molecular formula C20H11Cl2F6NO2 and a molecular weight of 482.21 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 10345145 |
| Molecular Formula | C20H11Cl2F6NO2 |
| Molecular Weight | 482.21 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 3,5-dichloro-N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]benzamide |
| SMILES | O=C(Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H11Cl2F6NO2/c21-12-7-11(8-13(22)9-12)17(30)29-16-14-4-2-1-3-10(14)5-6-15(16)18(31,19(23,24)25)20(26,27)28/h1-9,31H,(H,29,30) |
| InChIKey | CMSDXPRWNWLWKN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.21 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |