C30H42O5 — CID 10345180
(1R,6S,7S)-7-[(E)-6-(2,5-dimethoxy-3-methylphenyl)-4-methyl-2-oxohex-4-enyl]-4-methoxy-6,7,9,9-tetramethylbicyclo[4.2.1]non-3-en-2-one (PubChem CID 10345180) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is (1R,6S,7S)-7-[(E)-6-(2,5-dimethoxy-3-methylphenyl)-4-methyl-2-oxohex-4-enyl]-4-methoxy-6,7,9,9-tetramethylbicyclo[4.2.1]non-3-en-2-one.
| Compound Name | (1R,6S,7S)-7-[(E)-6-(2,5-dimethoxy-3-methylphenyl)-4-methyl-2-oxohex-4-enyl]-4-methoxy-6,7,9,9-tetramethylbicyclo[4.2.1]non-3-en-2-one |
|---|---|
| PubChem CID | 10345180 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | (1R,6S,7S)-7-[(E)-6-(2,5-dimethoxy-3-methylphenyl)-4-methyl-2-oxohex-4-enyl]-4-methoxy-6,7,9,9-tetramethylbicyclo[4.2.1]non-3-en-2-one |
| SMILES | COC1=CC(=O)[C@@H]2C[C@@](C)(CC(=O)C/C(C)=C/Cc3cc(OC)cc(C)c3OC)[C@](C)(C1)C2(C)C |
| InChI | InChI=1S/C30H42O5/c1-19(10-11-21-14-23(33-7)13-20(2)27(21)35-9)12-22(31)16-29(5)18-25-26(32)15-24(34-8)17-30(29,6)28(25,3)4/h10,13-15,25H,11-12,16-18H2,1-9H3/b19-10+/t25-,29+,30+/m0/s1 |
| InChIKey | ZSMAFRGUFTWCRD-VJPRSDKWSA-N |
| XLogP | 6.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|