C15H25BrN2O2 — CID 103451929
1-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-hydroxyethyl]cycloheptan-1-ol (PubChem CID 103451929) has the molecular formula C15H25BrN2O2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-hydroxyethyl]cycloheptan-1-ol.
| Compound Name | 1-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-hydroxyethyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103451929 |
| Molecular Formula | C15H25BrN2O2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[2-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-1-hydroxyethyl]cycloheptan-1-ol |
| SMILES | CCn1nc(C)c(Br)c1CC(O)C1(O)CCCCCC1 |
| InChI | InChI=1S/C15H25BrN2O2/c1-3-18-12(14(16)11(2)17-18)10-13(19)15(20)8-6-4-5-7-9-15/h13,19-20H,3-10H2,1-2H3 |
| InChIKey | UGRGYXJVDVZBSA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |