C16H24O3 — CID 103452088
1-[hydroxy-(4-methoxy-2-methylphenyl)methyl]cycloheptan-1-ol (PubChem CID 103452088) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 1-[hydroxy-(4-methoxy-2-methylphenyl)methyl]cycloheptan-1-ol.
| Compound Name | 1-[hydroxy-(4-methoxy-2-methylphenyl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103452088 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-[hydroxy-(4-methoxy-2-methylphenyl)methyl]cycloheptan-1-ol |
| SMILES | COc1ccc(C(O)C2(O)CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C16H24O3/c1-12-11-13(19-2)7-8-14(12)15(17)16(18)9-5-3-4-6-10-16/h7-8,11,15,17-18H,3-6,9-10H2,1-2H3 |
| InChIKey | QRIRSUREQZEPII-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |