C24H37FN2O5S — CID 10345248
(2S,4R)-4-[3-(4-fluorophenyl)propyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide (PubChem CID 10345248) has the molecular formula C24H37FN2O5S and a molecular weight of 484.63 g/mol. Its IUPAC name is (2S,4R)-4-[3-(4-fluorophenyl)propyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[3-(4-fluorophenyl)propyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10345248 |
| Molecular Formula | C24H37FN2O5S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (2S,4R)-4-[3-(4-fluorophenyl)propyl]-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@@H](CCCc3ccc(F)cc3)CN2)C(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H37FN2O5S/c1-13(2)18(22-20(29)19(28)21(30)24(32-22)33-3)27-23(31)17-11-15(12-26-17)6-4-5-14-7-9-16(25)10-8-14/h7-10,13,15,17-22,24,26,28-30H,4-6,11-12H2,1-3H3,(H,27,31)/t15-,17+,18-,19+,20-,21-,22-,24-/m1/s1 |
| InChIKey | ZFMDDZDIMRAHCT-HSVQUJDNSA-N |
| XLogP | 1.44 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |