C15H26N2O3 — CID 103452557
1-[hydroxy-(4-methoxy-1-propylpyrazol-5-yl)methyl]-4-methylcyclohexan-1-ol (PubChem CID 103452557) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[hydroxy-(4-methoxy-1-propylpyrazol-5-yl)methyl]-4-methylcyclohexan-1-ol.
| Compound Name | 1-[hydroxy-(4-methoxy-1-propylpyrazol-5-yl)methyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 103452557 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[hydroxy-(4-methoxy-1-propylpyrazol-5-yl)methyl]-4-methylcyclohexan-1-ol |
| SMILES | CCCn1ncc(OC)c1C(O)C1(O)CCC(C)CC1 |
| InChI | InChI=1S/C15H26N2O3/c1-4-9-17-13(12(20-3)10-16-17)14(18)15(19)7-5-11(2)6-8-15/h10-11,14,18-19H,4-9H2,1-3H3 |
| InChIKey | NNKHXCRMLNZLCE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |