C12H20O2 — CID 103453255
(E)-1-(2,2,5,5-tetramethyloxolan-3-yl)but-2-en-1-one (PubChem CID 103453255) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (E)-1-(2,2,5,5-tetramethyloxolan-3-yl)but-2-en-1-one.
| Compound Name | (E)-1-(2,2,5,5-tetramethyloxolan-3-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 103453255 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (E)-1-(2,2,5,5-tetramethyloxolan-3-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C12H20O2/c1-6-7-10(13)9-8-11(2,3)14-12(9,4)5/h6-7,9H,8H2,1-5H3/b7-6+ |
| InChIKey | NBVDZFALBQQUCS-VOTSOKGWSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|