C28H29N3O5 — CID 10345348
(2R)-2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid (PubChem CID 10345348) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is (2R)-2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid.
| Compound Name | (2R)-2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 10345348 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (2R)-2-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-4-(1,3-dioxobenzo[f]isoindol-2-yl)butanoic acid |
| SMILES | CC(C)C[C@H](N[C@H](CCN1C(=O)c2cc3ccccc3cc2C1=O)C(=O)O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H29N3O5/c1-17(2)14-24(25(32)29-20-10-4-3-5-11-20)30-23(28(35)36)12-13-31-26(33)21-15-18-8-6-7-9-19(18)16-22(21)27(31)34/h3-11,15-17,23-24,30H,12-14H2,1-2H3,(H,29,32)(H,35,36)/t23-,24+/m1/s1 |
| InChIKey | QTEIHMLBMPKKIZ-RPWUZVMVSA-N |
| XLogP | 3.92 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|