C28H33N5O3 — CID 10345355
5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide (PubChem CID 10345355) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide.
| Compound Name | 5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 10345355 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 5-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)oxy]-N'-(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)furan-2-carbohydrazide |
| SMILES | Cc1cc(NNC(=O)c2ccc(Oc3ccc4c(c3)C(C)(C)CCC4(C)C)o2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C28H33N5O3/c1-16-14-22(29-25-24(16)17(2)32-33(25)7)30-31-26(34)21-10-11-23(36-21)35-18-8-9-19-20(15-18)28(5,6)13-12-27(19,3)4/h8-11,14-15H,12-13H2,1-7H3,(H,29,30)(H,31,34) |
| InChIKey | YORFHTZTNCMNIA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|